| MolName | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-(3-chlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C21H17N3O3Cl2S |
| Smiles | O=C(CN(c(cc1)ccc1Cl)S(c1ccccc1)(=O)=O)N/N=C\c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N3O3S/c22-17-9-11-19(12-10-17)26(30(28,29)20-7-2-1-3-8-20)15-21(27)25-24-14-16-5-4-6-18(23)13-16/h1-14H,15H2,(H,25,27) |
| InChIK | OSBICSCEIQSSMW-UHFFFAOYSA-N |
| TotalMolweight | 462.356 |
| Molweight | 462.356 |
| MonoisotopicMass | 461.036766 |
| CLogP | 4.2628 |
| CLogS | -6.398 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 330.23 |
| Relative PSA | 0.20634 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -0.56068 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-(3-chlorophenyl)methylideneamino]acetamide | 2 - 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-(3-chlorophenyl)methylideneamino]acetamide