| MolName | 4-chloro-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide |
| MolecularFormula | C13H10N3OCl |
| Smiles | O=C(c(cc1)ccc1Cl)N/N=C\c1ncccc1 |
| InChI | InChI=1S/C13H10ClN3O/c14-11-6-4-10(5-7-11)13(18)17-16-9-12-3-1-2-8-15-12/h1-9H,(H,17,18) |
| InChIK | OSEOOXCLAYRSPE-UHFFFAOYSA-N |
| TotalMolweight | 259.695 |
| Molweight | 259.695 |
| MonoisotopicMass | 259.051239 |
| CLogP | 2.8607 |
| CLogS | -3.686 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 201.17 |
| Relative PSA | 0.23353 |
| PolarSurfaceArea | 54.35 |
| Druglikeness | 4.4715 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide