| MolName | [3-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C21H13N2O3Cl3 |
| Smiles | O=C(c(cc1)cc(Cl)c1Cl)N/N=C\c1cc(OC(c(cc2)ccc2Cl)=O)ccc1 |
| InChI | InChI=1S/C21H13Cl3N2O3/c22-16-7-4-14(5-8-16)21(28)29-17-3-1-2-13(10-17)12-25-26-20(27)15-6-9-18(23)19(24)11-15/h1-12H,(H,26,27) |
| InChIK | OSKFFRLAIZMLMK-UHFFFAOYSA-N |
| TotalMolweight | 447.704 |
| Molweight | 447.704 |
| MonoisotopicMass | 445.999174 |
| CLogP | 6.4501 |
| CLogS | -7.399 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 320.76 |
| Relative PSA | 0.18409 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 4.0416 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate