| MolName | (Z)-N-[(Z)-benzylideneamino]-4-(4-chlorophenyl)-3-(furan-2-ylmethyl)-1,3-thiazol-2-imine |
| MolecularFormula | C21H16N3OClS |
| Smiles | Clc(cc1)ccc1C(N1Cc2ccco2)=CS/C1=N\N=C/c1ccccc1 |
| InChI | InChI=1S/C21H16ClN3OS/c22-18-10-8-17(9-11-18)20-15-27-21(25(20)14-19-7-4-12-26-19)24-23-13-16-5-2-1-3-6-16/h1-13,15H,14H2 |
| InChIK | OSYQYWSAJYXGJL-UHFFFAOYSA-N |
| TotalMolweight | 393.897 |
| Molweight | 393.897 |
| MonoisotopicMass | 393.070259 |
| CLogP | 6.671 |
| CLogS | -6.392 |
| H Acceptors | 4 |
| TotalSurfaceArea | 298.38 |
| Relative PSA | 0.19495 |
| PolarSurfaceArea | 66.4 |
| Druglikeness | 4.0992 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-benzylideneamino]-4-(4-chlorophenyl)-3-(furan-2-ylmethyl)-1,3-thiazol-2-imine | 2 - (Z)-N-[(Z)-benzylideneamino]-4-(4-chlorophenyl)-3-(furan-2-ylmethyl)-1,3-thiazol-2-imine