| MolName | N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C18H21N3O2S |
| Smiles | O=S(c1ccccc1)(N/N=C\c(cc1)ccc1N1CCCCC1)=O |
| InChI | InChI=1S/C18H21N3O2S/c22-24(23,18-7-3-1-4-8-18)20-19-15-16-9-11-17(12-10-16)21-13-5-2-6-14-21/h1,3-4,7-12,15,20H,2,5-6,13-14H2 |
| InChIK | OTDACPFHNXROEY-UHFFFAOYSA-N |
| TotalMolweight | 343.45 |
| Molweight | 343.45 |
| MonoisotopicMass | 343.135447 |
| CLogP | 3.1101 |
| CLogS | -2.908 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 263.42 |
| Relative PSA | 0.20917 |
| PolarSurfaceArea | 70.15 |
| Druglikeness | -4.6143 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzenesulfonamide