| MolName | N-[(Z)-(2-iodophenyl)methylideneamino]pyridine-2-carboxamide |
| MolecularFormula | C13H10N3OI |
| Smiles | O=C(c1ncccc1)N/N=C\c(cccc1)c1I |
| InChI | InChI=1S/C13H10IN3O/c14-11-6-2-1-5-10(11)9-16-17-13(18)12-7-3-4-8-15-12/h1-9H,(H,17,18) |
| InChIK | OTHXVVMISUUORV-UHFFFAOYSA-N |
| TotalMolweight | 351.142 |
| Molweight | 351.142 |
| MonoisotopicMass | 350.98686 |
| CLogP | 2.6918 |
| CLogS | -3.966 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 212.03 |
| Relative PSA | 0.22157 |
| PolarSurfaceArea | 54.35 |
| Druglikeness | 4.9031 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-iodophenyl)methylideneamino]pyridine-2-carboxamide | 2 - N-[(Z)-(2-iodophenyl)methylideneamino]pyridine-2-carboxamide