| MolName | 2-amino-1-[(3,4-dihydroxyphenyl)methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C23H22N6O4 |
| Smiles | Nc1c(C(NC[C@H]2OCCC2)=O)c2nc3ccccc3nc2n1N=Cc(cc1)cc(O)c1O |
| InChI | InChI=1S/C23H22N6O4/c24-21-19(23(32)25-12-14-4-3-9-33-14)20-22(28-16-6-2-1-5-15(16)27-20)29(21)26-11-13-7-8-17(30)18(31)10-13/h1-2,5-8,10-11,14,30-31H,3-4,9,12,24H2,(H,25,32)/t14-/m0/s1 |
| InChIK | OTQSDBCOMHJBFH-AWEZNQCLSA-N |
| TotalMolweight | 446.466 |
| Molweight | 446.466 |
| MonoisotopicMass | 446.170254 |
| CLogP | 2.0621 |
| CLogS | -7.13 |
| H Acceptors | 10 |
| H Donors | 4 |
| TotalSurfaceArea | 328.17 |
| Relative PSA | 0.35436 |
| PolarSurfaceArea | 147.88 |
| Druglikeness | 4.351 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 9 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-amino-1-[(3,4-dihydroxyphenyl)methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-1-[(3,4-dihydroxyphenyl)methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide