| MolName | (Z)-1-(4-chloro-3-nitrophenyl)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]methanimine |
| MolecularFormula | C24H21N4O2Cl |
| Smiles | [O-][N+](c(cc(/C=N\N(CC1)CCN1C1c(cccc2)c2-c2c1cccc2)cc1)c1Cl)=O |
| InChI | InChI=1S/C24H21ClN4O2/c25-22-10-9-17(15-23(22)29(30)31)16-26-28-13-11-27(12-14-28)24-20-7-3-1-5-18(20)19-6-2-4-8-21(19)24/h1-10,15-16,24H,11-14H2 |
| InChIK | OUAAZFLOWQCWRL-UHFFFAOYSA-N |
| TotalMolweight | 432.91 |
| Molweight | 432.91 |
| MonoisotopicMass | 432.135303 |
| CLogP | 3.6667 |
| CLogS | -6.112 |
| H Acceptors | 6 |
| TotalSurfaceArea | 317.77 |
| Relative PSA | 0.15429 |
| PolarSurfaceArea | 64.66 |
| Druglikeness | 1.5338 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 8 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-chloro-3-nitrophenyl)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]methanimine | 2 - (Z)-1-(4-chloro-3-nitrophenyl)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]methanimine