| MolName | (Z)-1-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-piperidin-1-ylmethanimine |
| MolecularFormula | C23H22N4O |
| Smiles | C(CC1)CCN1/N=C\c1cn(-c2ccccc2)nc1-c1cc(cccc2)c2o1 |
| InChI | InChI=1S/C23H22N4O/c1-3-10-20(11-4-1)27-17-19(16-24-26-13-7-2-8-14-26)23(25-27)22-15-18-9-5-6-12-21(18)28-22/h1,3-6,9-12,15-17H,2,7-8,13-14H2 |
| InChIK | OUCMPZLWCOOCTA-UHFFFAOYSA-N |
| TotalMolweight | 370.455 |
| Molweight | 370.455 |
| MonoisotopicMass | 370.179361 |
| CLogP | 4.1171 |
| CLogS | -5.084 |
| H Acceptors | 5 |
| TotalSurfaceArea | 295.39 |
| Relative PSA | 0.15915 |
| PolarSurfaceArea | 46.56 |
| Druglikeness | 2.34 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-piperidin-1-ylmethanimine | 2 - (Z)-1-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-piperidin-1-ylmethanimine