| MolName | N-[(Z)-[1-[2-(2-prop-2-enylphenoxy)ethyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C27H24N4OS |
| Smiles | C=CCc(cccc1)c1OCCn1c(cccc2)c2c(/C=N\Nc2nc(cccc3)c3s2)c1 |
| InChI | InChI=1S/C27H24N4OS/c1-2-9-20-10-3-7-14-25(20)32-17-16-31-19-21(22-11-4-6-13-24(22)31)18-28-30-27-29-23-12-5-8-15-26(23)33-27/h2-8,10-15,18-19H,1,9,16-17H2,(H,29,30) |
| InChIK | OUCYXIGZPJLTHG-UHFFFAOYSA-N |
| TotalMolweight | 452.581 |
| Molweight | 452.581 |
| MonoisotopicMass | 452.167081 |
| CLogP | 8.1186 |
| CLogS | -5.971 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 357.92 |
| Relative PSA | 0.19884 |
| PolarSurfaceArea | 79.68 |
| Druglikeness | 1.8701 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[2-(2-prop-2-enylphenoxy)ethyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-[1-[2-(2-prop-2-enylphenoxy)ethyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine