| MolName | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C36H30N4O7Cl2 |
| Smiles | O=C(C(N/N=C\c(ccc(OC(c(cc1)ccc1Cl)=O)c1)c1OC(c(cc1)ccc1Cl)=O)=O)Nc(cccc1)c1C(NC1CCCCC1)=O |
| InChI | InChI=1S/C36H30Cl2N4O7/c37-25-15-10-22(11-16-25)35(46)48-28-19-14-24(31(20-28)49-36(47)23-12-17-26(38)18-13-23)21-39-42-34(45)33(44)41-30-9-5-4-8-29(30)32(43)40-27-6-2-1-3-7-27/h4-5,8-21,27H,1-3,6-7H2,(H,40,43)(H,41,44)(H,42,45) |
| InChIK | OUFNCGYLDCBWQQ-UHFFFAOYSA-N |
| TotalMolweight | 701.561 |
| Molweight | 701.561 |
| MonoisotopicMass | 700.149155 |
| CLogP | 7.2114 |
| CLogS | -9.516 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 519.07 |
| Relative PSA | 0.25255 |
| PolarSurfaceArea | 152.26 |
| Druglikeness | -0.73762 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.5102 |
| Fragments | 1 |
| Non HAtoms | 49 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 12 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate