| MolName | 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H13N3O5BrI |
| Smiles | [O-][N+](c(cc1)cc(Br)c1OCC(N/N=C\c1ccc(-c(cc2)ccc2I)o1)=O)=O |
| InChI | InChI=1S/C19H13BrIN3O5/c20-16-9-14(24(26)27)5-7-18(16)28-11-19(25)23-22-10-15-6-8-17(29-15)12-1-3-13(21)4-2-12/h1-10H,11H2,(H,23,25) |
| InChIK | OUFPBFMHYYZVEF-UHFFFAOYSA-N |
| TotalMolweight | 570.132 |
| Molweight | 570.132 |
| MonoisotopicMass | 568.908331 |
| CLogP | 3.9561 |
| CLogS | -7.271 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 328.78 |
| Relative PSA | 0.27538 |
| PolarSurfaceArea | 109.65 |
| Druglikeness | -0.058735 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]acetamide