| MolName | [4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C26H19N2O4Cl |
| Smiles | O=C(COc1cc2ccccc2cc1)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C26H19ClN2O4/c27-24-8-4-3-7-23(24)26(31)33-21-12-9-18(10-13-21)16-28-29-25(30)17-32-22-14-11-19-5-1-2-6-20(19)15-22/h1-16H,17H2,(H,29,30) |
| InChIK | OUUMKJRQMVWNFU-UHFFFAOYSA-N |
| TotalMolweight | 458.9 |
| Molweight | 458.9 |
| MonoisotopicMass | 458.103335 |
| CLogP | 6.0074 |
| CLogS | -7.313 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 348.28 |
| Relative PSA | 0.19826 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 4.0206 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate