| MolName | (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]methanimine |
| MolecularFormula | C18H12N2O4F8 |
| Smiles | FC(Oc1cc(OC(F)F)c(/C=N\N=C/c(ccc(OC(F)F)c2)c2OC(F)F)cc1)F |
| InChI | InChI=1S/C18H12F8N2O4/c19-15(20)29-11-3-1-9(13(5-11)31-17(23)24)7-27-28-8-10-2-4-12(30-16(21)22)6-14(10)32-18(25)26/h1-8,15-18H |
| InChIK | OUUOOCZQPMGLAY-UHFFFAOYSA-N |
| TotalMolweight | 472.287 |
| Molweight | 472.287 |
| MonoisotopicMass | 472.066932 |
| CLogP | 5.4632 |
| CLogS | -6.62 |
| H Acceptors | 6 |
| TotalSurfaceArea | 323.34 |
| Relative PSA | 0.1949 |
| PolarSurfaceArea | 61.64 |
| Druglikeness | -1.323 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 11 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 18 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]methanimine | 2 - (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]methanimine