| MolName | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
| MolecularFormula | C18H13N4O3Cl |
| Smiles | O=C(c1cc(-c2ccccc2)n[nH]1)N/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C18H13ClN4O3/c19-13-7-17-16(25-10-26-17)6-12(13)9-20-23-18(24)15-8-14(21-22-15)11-4-2-1-3-5-11/h1-9H,10H2,(H,21,22)(H,23,24) |
| InChIK | OUWZZZOUGSCRTL-UHFFFAOYSA-N |
| TotalMolweight | 368.779 |
| Molweight | 368.779 |
| MonoisotopicMass | 368.067618 |
| CLogP | 3.6168 |
| CLogS | -5.543 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 270.76 |
| Relative PSA | 0.29905 |
| PolarSurfaceArea | 88.6 |
| Druglikeness | 5.5292 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide