| MolName | 4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C19H23N7O4 |
| Smiles | OC(c1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1)=O |
| InChI | InChI=1S/C19H23N7O4/c27-16(28)15-3-1-14(2-4-15)13-20-24-17-21-18(25-5-9-29-10-6-25)23-19(22-17)26-7-11-30-12-8-26/h1-4,13H,5-12H2,(H,27,28)(H,21,22,23,24) |
| InChIK | OVRNNRNVCQVPPQ-UHFFFAOYSA-N |
| TotalMolweight | 413.437 |
| Molweight | 413.437 |
| MonoisotopicMass | 413.181153 |
| CLogP | 2.5744 |
| CLogS | -3.554 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 313.3 |
| Relative PSA | 0.34829 |
| PolarSurfaceArea | 125.3 |
| Druglikeness | 3.0971 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzoic acid