| MolName | N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2H-tetrazol-5-amine |
| MolecularFormula | C12H8N7O3Cl |
| Smiles | [O-][N+](c(cc1)cc(-c2ccc(/C=N\Nc3n[nH]nn3)o2)c1Cl)=O |
| InChI | InChI=1S/C12H8ClN7O3/c13-10-3-1-7(20(21)22)5-9(10)11-4-2-8(23-11)6-14-15-12-16-18-19-17-12/h1-6H,(H2,15,16,17,18,19) |
| InChIK | OVTBBVWNLICDRF-UHFFFAOYSA-N |
| TotalMolweight | 333.695 |
| Molweight | 333.695 |
| MonoisotopicMass | 333.037715 |
| CLogP | 3.4571 |
| CLogS | -5.213 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 243.63 |
| Relative PSA | 0.46956 |
| PolarSurfaceArea | 137.81 |
| Druglikeness | -4.6575 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2H-tetrazol-5-amine | 2 - N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2H-tetrazol-5-amine