| MolName | 2,4-difluoro-N-[(Z)-(3-phenoxyphenyl)methylideneamino]aniline |
| MolecularFormula | C19H14N2OF2 |
| Smiles | Fc(cc1)cc(F)c1N/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C19H14F2N2O/c20-15-9-10-19(18(21)12-15)23-22-13-14-5-4-8-17(11-14)24-16-6-2-1-3-7-16/h1-13,23H |
| InChIK | OVUXTNGETHCWKA-UHFFFAOYSA-N |
| TotalMolweight | 324.329 |
| Molweight | 324.329 |
| MonoisotopicMass | 324.107419 |
| CLogP | 6.4381 |
| CLogS | -6.074 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 251.7 |
| Relative PSA | 0.13099 |
| PolarSurfaceArea | 33.62 |
| Druglikeness | 0.68344 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-difluoro-N-[(Z)-(3-phenoxyphenyl)methylideneamino]aniline | 2 - 2,4-difluoro-N-[(Z)-(3-phenoxyphenyl)methylideneamino]aniline