| MolName | 5-[[(E)-3-phenylprop-2-enylidene]amino]-1,3-dihydrobenzimidazol-2-one |
| MolecularFormula | C16H13N3O |
| Smiles | O=C1Nc(cc(cc2)/N=C/C=C/c3ccccc3)c2N1 |
| InChI | InChI=1S/C16H13N3O/c20-16-18-14-9-8-13(11-15(14)19-16)17-10-4-7-12-5-2-1-3-6-12/h1-11H,(H2,18,19,20) |
| InChIK | OWQVPADCEPIOIO-UHFFFAOYSA-N |
| TotalMolweight | 263.299 |
| Molweight | 263.299 |
| MonoisotopicMass | 263.105862 |
| CLogP | 1.9434 |
| CLogS | -4.392 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 211.45 |
| Relative PSA | 0.2245 |
| PolarSurfaceArea | 53.49 |
| Druglikeness | 0.8571 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-[[(E)-3-phenylprop-2-enylidene]amino]-1,3-dihydrobenzimidazol-2-one | 2 - 5-[[(E)-3-phenylprop-2-enylidene]amino]-1,3-dihydrobenzimidazol-2-one