| MolName | N-(2-phenylphenyl)-N'-[(Z)-quinolin-3-ylmethylideneamino]oxamide |
| MolecularFormula | C24H18N4O2 |
| Smiles | O=C(C(N/N=C\c1cc2ccccc2nc1)=O)Nc(cccc1)c1-c1ccccc1 |
| InChI | InChI=1S/C24H18N4O2/c29-23(27-22-13-7-5-11-20(22)18-8-2-1-3-9-18)24(30)28-26-16-17-14-19-10-4-6-12-21(19)25-15-17/h1-16H,(H,27,29)(H,28,30) |
| InChIK | OWWIROBAAUPEEB-UHFFFAOYSA-N |
| TotalMolweight | 394.433 |
| Molweight | 394.433 |
| MonoisotopicMass | 394.142976 |
| CLogP | 4.1191 |
| CLogS | -6.317 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 309.32 |
| Relative PSA | 0.23109 |
| PolarSurfaceArea | 83.45 |
| Druglikeness | 3.7478 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-phenylphenyl)-N'-[(Z)-quinolin-3-ylmethylideneamino]oxamide | 2 - N-(2-phenylphenyl)-N'-[(Z)-quinolin-3-ylmethylideneamino]oxamide