| MolName | 2-[2-[(Z)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C11H12N6O3 |
| Smiles | Nn1c(N/N=C\c(cccc2)c2OCC(O)=O)nnc1 |
| InChI | InChI=1S/C11H12N6O3/c12-17-7-14-16-11(17)15-13-5-8-3-1-2-4-9(8)20-6-10(18)19/h1-5,7H,6,12H2,(H,15,16)(H,18,19) |
| InChIK | OXEMUZLKRIESFN-UHFFFAOYSA-N |
| TotalMolweight | 276.255 |
| Molweight | 276.255 |
| MonoisotopicMass | 276.097089 |
| CLogP | 2.1593 |
| CLogS | -4.547 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 212.34 |
| Relative PSA | 0.48597 |
| PolarSurfaceArea | 127.65 |
| Druglikeness | 1.7784 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenoxy]acetic acid