| MolName | 1-(2,1,3-benzothiadiazol-4-yl)-3-[(Z)-(4-bromophenyl)methylideneamino]urea |
| MolecularFormula | C14H10N5OBrS |
| Smiles | O=C(Nc1cccc2nsnc12)N/N=C\c(cc1)ccc1Br |
| InChI | InChI=1S/C14H10BrN5OS/c15-10-6-4-9(5-7-10)8-16-18-14(21)17-11-2-1-3-12-13(11)20-22-19-12/h1-8H,(H2,17,18,21) |
| InChIK | OXOVQOKEKQREMV-UHFFFAOYSA-N |
| TotalMolweight | 376.237 |
| Molweight | 376.237 |
| MonoisotopicMass | 374.978941 |
| CLogP | 4.4373 |
| CLogS | -1.703 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 245.14 |
| Relative PSA | 0.3662 |
| PolarSurfaceArea | 107.51 |
| Druglikeness | 3.515 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2,1,3-benzothiadiazol-4-yl)-3-[(Z)-(4-bromophenyl)methylideneamino]urea | 2 - 1-(2,1,3-benzothiadiazol-4-yl)-3-[(Z)-(4-bromophenyl)methylideneamino]urea