| MolName | N,4-bis[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazol-3-amine |
| MolecularFormula | C18H12N8O8 |
| Smiles | [O-][N+](c1c(/C=N\Nc2nncn2/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)cc2OCOc2c1)=O |
| InChI | InChI=1S/C18H12N8O8/c27-25(28)12-3-16-14(31-8-33-16)1-10(12)5-19-22-18-23-20-7-24(18)21-6-11-2-15-17(34-9-32-15)4-13(11)26(29)30/h1-7H,8-9H2,(H,22,23) |
| InChIK | OXZUNDAOMXCEGW-UHFFFAOYSA-N |
| TotalMolweight | 468.341 |
| Molweight | 468.341 |
| MonoisotopicMass | 468.077812 |
| CLogP | 3.2552 |
| CLogS | -8.456 |
| H Acceptors | 16 |
| H Donors | 1 |
| TotalSurfaceArea | 328.34 |
| Relative PSA | 0.49988 |
| PolarSurfaceArea | 196.02 |
| Druglikeness | -0.91569 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 8 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,4-bis[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazol-3-amine | 2 - N,4-bis[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazol-3-amine