| MolName | [1-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate |
| MolecularFormula | C28H18N5O4ClS |
| Smiles | O=C(C(N/N=C\c(c1ccccc1cc1)c1OC(c(cc1)ccc1Cl)=O)=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C28H18ClN5O4S/c29-20-13-10-19(11-14-20)27(37)38-23-15-12-17-6-4-5-9-21(17)22(23)16-30-32-25(36)24(35)31-28-34-33-26(39-28)18-7-2-1-3-8-18/h1-16H,(H,32,36)(H,31,34,35) |
| InChIK | OYTQODFAGKPVLG-UHFFFAOYSA-N |
| TotalMolweight | 556.001 |
| Molweight | 556.001 |
| MonoisotopicMass | 555.076802 |
| CLogP | 6.0428 |
| CLogS | -7.841 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 406.95 |
| Relative PSA | 0.30925 |
| PolarSurfaceArea | 150.88 |
| Druglikeness | 4.8849 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.5641 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate | 2 - [1-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate