| MolName | 1-phenyl-3-[(E)-[4-[[3-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]-1,4-dioxan-2-yl]oxy]phenyl]methylideneamino]urea |
| MolecularFormula | C32H30N6O6 |
| Smiles | O=C(Nc1ccccc1)N/N=C/c(cc1)ccc1OC1OCCOC1Oc1ccc(/C=N\NC(Nc2ccccc2)=O)cc1 |
| InChI | InChI=1S/C32H30N6O6/c39-31(35-25-7-3-1-4-8-25)37-33-21-23-11-15-27(16-12-23)43-29-30(42-20-19-41-29)44-28-17-13-24(14-18-28)22-34-38-32(40)36-26-9-5-2-6-10-26/h1-18,21-22,29-30H,19-20H2,(H2,35,37,39)(H2,36,38,40) |
| InChIK | OZKLUQOFQLAQCL-UHFFFAOYSA-N |
| TotalMolweight | 594.626 |
| Molweight | 594.626 |
| MonoisotopicMass | 594.222684 |
| CLogP | 5.9856 |
| CLogS | -8.156 |
| H Acceptors | 12 |
| H Donors | 4 |
| TotalSurfaceArea | 462.42 |
| Relative PSA | 0.29181 |
| PolarSurfaceArea | 143.9 |
| Druglikeness | -3.2864 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| StereoCenters | 2 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 8 |
| Symmetricatoms | 8 |
| Amides | 2 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - 1-phenyl-3-[(E)-[4-[[3-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]-1,4-dioxan-2-yl]oxy]phenyl]methylideneamino]urea | 2 - 1-phenyl-3-[(E)-[4-[[3-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]-1,4-dioxan-2-yl]oxy]phenyl]methylideneamino]urea