| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C18H20N9O2F |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cccc2)c2F)=O)c1CN1CCCCC1 |
| InChI | InChI=1S/C18H20FN9O2/c19-13-7-3-2-6-12(13)10-21-23-18(29)15-14(11-27-8-4-1-5-9-27)28(26-22-15)17-16(20)24-30-25-17/h2-3,6-7,10H,1,4-5,8-9,11H2,(H2,20,24)(H,23,29) |
| InChIK | OZRABHFOOOPICY-UHFFFAOYSA-N |
| TotalMolweight | 413.416 |
| Molweight | 413.416 |
| MonoisotopicMass | 413.172399 |
| CLogP | 2.6061 |
| CLogS | -2.236 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 314.91 |
| Relative PSA | 0.38008 |
| PolarSurfaceArea | 140.35 |
| Druglikeness | 0.44963 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide