| MolName | N-[(Z)-(2,4-difluorophenyl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| MolecularFormula | C20H21N3O4F2S |
| Smiles | O=C(CCc(cc1)ccc1S(N1CCOCC1)(=O)=O)N/N=C\c(ccc(F)c1)c1F |
| InChI | InChI=1S/C20H21F2N3O4S/c21-17-5-4-16(19(22)13-17)14-23-24-20(26)8-3-15-1-6-18(7-2-15)30(27,28)25-9-11-29-12-10-25/h1-2,4-7,13-14H,3,8-12H2,(H,24,26) |
| InChIK | OZWWUVIAKZJSCP-UHFFFAOYSA-N |
| TotalMolweight | 437.466 |
| Molweight | 437.466 |
| MonoisotopicMass | 437.122083 |
| CLogP | 2.8985 |
| CLogS | -3.79 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 317.63 |
| Relative PSA | 0.24601 |
| PolarSurfaceArea | 96.45 |
| Druglikeness | 3.2772 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide | 2 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide