| MolName | [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| MolecularFormula | C27H20N3O4I |
| Smiles | O=C(CNC(c1cccc2ccccc12)=O)N/N=C\c(cc1)ccc1OC(c(cccc1)c1I)=O |
| InChI | InChI=1S/C27H20IN3O4/c28-24-11-4-3-9-23(24)27(34)35-20-14-12-18(13-15-20)16-30-31-25(32)17-29-26(33)22-10-5-7-19-6-1-2-8-21(19)22/h1-16H,17H2,(H,29,33)(H,31,32) |
| InChIK | PAOJDCZHVNNCFT-UHFFFAOYSA-N |
| TotalMolweight | 577.373 |
| Molweight | 577.373 |
| MonoisotopicMass | 577.049855 |
| CLogP | 5.3473 |
| CLogS | -7.58 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 378.35 |
| Relative PSA | 0.22083 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.4723 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate | 2 - [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate