| MolName | N-[(Z)-[(2E)-2-phenyl-2-(phenylhydrazinylidene)ethylidene]amino]aniline |
| MolecularFormula | C20H18N4 |
| Smiles | C(/C(/c1ccccc1)=N/Nc1ccccc1)=N\Nc1ccccc1 |
| InChI | InChI=1S/C20H18N4/c1-4-10-17(11-5-1)20(24-23-19-14-8-3-9-15-19)16-21-22-18-12-6-2-7-13-18/h1-16,22-23H |
| InChIK | PAOZABFHQVNJMH-UHFFFAOYSA-N |
| TotalMolweight | 314.391 |
| Molweight | 314.391 |
| MonoisotopicMass | 314.153146 |
| CLogP | 6.8878 |
| CLogS | -4.426 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 263.43 |
| Relative PSA | 0.17439 |
| PolarSurfaceArea | 48.78 |
| Druglikeness | 2.557 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(2E)-2-phenyl-2-(phenylhydrazinylidene)ethylidene]amino]aniline | 2 - N-[(Z)-[(2E)-2-phenyl-2-(phenylhydrazinylidene)ethylidene]amino]aniline