| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[(E)-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C26H20N4O6 |
| Smiles | [O-][N+](c1ccc(/C=C/C=N\NC(/C(/NC(c2ccccc2)=O)=C\c(cc2)cc3c2OCO3)=O)cc1)=O |
| InChI | InChI=1S/C26H20N4O6/c31-25(20-6-2-1-3-7-20)28-22(15-19-10-13-23-24(16-19)36-17-35-23)26(32)29-27-14-4-5-18-8-11-21(12-9-18)30(33)34/h1-16H,17H2,(H,28,31)(H,29,32) |
| InChIK | PAQMUEGKLJUSJK-UHFFFAOYSA-N |
| TotalMolweight | 484.467 |
| Molweight | 484.467 |
| MonoisotopicMass | 484.138286 |
| CLogP | 4.0264 |
| CLogS | -6.929 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 371.1 |
| Relative PSA | 0.29892 |
| PolarSurfaceArea | 134.84 |
| Druglikeness | 1.2208 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[(E)-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[(E)-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide