| MolName | 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C20H24N4O2 |
| Smiles | Oc1cccc(/C=N\NC(CN2CCN(Cc3ccccc3)CC2)=O)c1 |
| InChI | InChI=1S/C20H24N4O2/c25-19-8-4-7-18(13-19)14-21-22-20(26)16-24-11-9-23(10-12-24)15-17-5-2-1-3-6-17/h1-8,13-14,25H,9-12,15-16H2,(H,22,26) |
| InChIK | PAULTJLCXCBRGJ-UHFFFAOYSA-N |
| TotalMolweight | 352.437 |
| Molweight | 352.437 |
| MonoisotopicMass | 352.189926 |
| CLogP | 2.2021 |
| CLogS | -2.27 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 283 |
| Relative PSA | 0.19862 |
| PolarSurfaceArea | 68.17 |
| Druglikeness | 9.2556 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide | 2 - 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide