| MolName | 3-(4-phenylpiperazin-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]propanamide |
| MolecularFormula | C19H23N5O |
| Smiles | O=C(CCN(CC1)CCN1c1ccccc1)N/N=C\c1cnccc1 |
| InChI | InChI=1S/C19H23N5O/c25-19(22-21-16-17-5-4-9-20-15-17)8-10-23-11-13-24(14-12-23)18-6-2-1-3-7-18/h1-7,9,15-16H,8,10-14H2,(H,22,25) |
| InChIK | PAYCDBCAFMXABI-UHFFFAOYSA-N |
| TotalMolweight | 337.426 |
| Molweight | 337.426 |
| MonoisotopicMass | 337.19026 |
| CLogP | 2.0784 |
| CLogS | -2.563 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 275.41 |
| Relative PSA | 0.19636 |
| PolarSurfaceArea | 60.83 |
| Druglikeness | 10.282 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amines | 2 |
| AlkylAmines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-phenylpiperazin-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]propanamide | 2 - 3-(4-phenylpiperazin-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]propanamide