| MolName | [3-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C23H17N3O8 |
| Smiles | [O-][N+](c(cccc1)c1OCC(N/N=C\c1cc(OC(c(cc2)cc3c2OCO3)=O)ccc1)=O)=O |
| InChI | InChI=1S/C23H17N3O8/c27-22(13-31-19-7-2-1-6-18(19)26(29)30)25-24-12-15-4-3-5-17(10-15)34-23(28)16-8-9-20-21(11-16)33-14-32-20/h1-12H,13-14H2,(H,25,27) |
| InChIK | PBCCGDNGEDHIQB-UHFFFAOYSA-N |
| TotalMolweight | 463.401 |
| Molweight | 463.401 |
| MonoisotopicMass | 463.101567 |
| CLogP | 3.3968 |
| CLogS | -6.142 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 342.19 |
| Relative PSA | 0.34913 |
| PolarSurfaceArea | 141.27 |
| Druglikeness | -1.1079 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [3-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate