| MolName | 2-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
| MolecularFormula | C16H14N3O3F3S2 |
| Smiles | O=C(CSCC(N/N=C\c1cccs1)=O)Nc(cc1)ccc1OC(F)(F)F |
| InChI | InChI=1S/C16H14F3N3O3S2/c17-16(18,19)25-12-5-3-11(4-6-12)21-14(23)9-26-10-15(24)22-20-8-13-2-1-7-27-13/h1-8H,9-10H2,(H,21,23)(H,22,24) |
| InChIK | PCGLCAVOUOMLEU-UHFFFAOYSA-N |
| TotalMolweight | 417.431 |
| Molweight | 417.431 |
| MonoisotopicMass | 417.042866 |
| CLogP | 3.7557 |
| CLogS | -5.165 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 296.61 |
| Relative PSA | 0.36533 |
| PolarSurfaceArea | 133.33 |
| Druglikeness | -1.6187 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide | 2 - 2-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide