| MolName | 4-[(Z)-benzylideneamino]-3-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-5-one |
| MolecularFormula | C16H14N6O |
| Smiles | O=C(NN=C1N/N=C\c2ccccc2)N1/N=C\c1ccccc1 |
| InChI | InChI=1S/C16H14N6O/c23-16-21-20-15(19-17-11-13-7-3-1-4-8-13)22(16)18-12-14-9-5-2-6-10-14/h1-12H,(H,19,20)(H,21,23) |
| InChIK | PCIMBJDKKMXNCX-UHFFFAOYSA-N |
| TotalMolweight | 306.328 |
| Molweight | 306.328 |
| MonoisotopicMass | 306.122909 |
| CLogP | 3.3178 |
| CLogS | -5.476 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 242.98 |
| Relative PSA | 0.30472 |
| PolarSurfaceArea | 81.45 |
| Druglikeness | 4.8829 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-benzylideneamino]-3-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-5-one | 2 - 4-[(Z)-benzylideneamino]-3-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-5-one