| MolName | N,N'-bis[(Z)-(3-nitrophenyl)methylideneamino]octanediamide |
| MolecularFormula | C22H24N6O6 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(CCCCCCC(N/N=C\c2cccc([N+]([O-])=O)c2)=O)=O)c1)=O |
| InChI | InChI=1S/C22H24N6O6/c29-21(25-23-15-17-7-5-9-19(13-17)27(31)32)11-3-1-2-4-12-22(30)26-24-16-18-8-6-10-20(14-18)28(33)34/h5-10,13-16H,1-4,11-12H2,(H,25,29)(H,26,30) |
| InChIK | PCXLPNMVRLIVCZ-UHFFFAOYSA-N |
| TotalMolweight | 468.469 |
| Molweight | 468.469 |
| MonoisotopicMass | 468.175734 |
| CLogP | 3.4216 |
| CLogS | -6.658 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 370.86 |
| Relative PSA | 0.35825 |
| PolarSurfaceArea | 174.56 |
| Druglikeness | -9.2744 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 13 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 17 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(3-nitrophenyl)methylideneamino]octanediamide | 2 - N,N'-bis[(Z)-(3-nitrophenyl)methylideneamino]octanediamide