| MolName | 6-amino-N-[(Z)-2H-chromen-3-ylmethylideneamino]hexanamide |
| MolecularFormula | C16H21N3O2 |
| Smiles | NCCCCCC(N/N=C\C1=Cc(cccc2)c2OC1)=O |
| InChI | InChI=1S/C16H21N3O2/c17-9-5-1-2-8-16(20)19-18-11-13-10-14-6-3-4-7-15(14)21-12-13/h3-4,6-7,10-11H,1-2,5,8-9,12,17H2,(H,19,20) |
| InChIK | PCZMZLVFPDEJOT-UHFFFAOYSA-N |
| TotalMolweight | 287.362 |
| Molweight | 287.362 |
| MonoisotopicMass | 287.163377 |
| CLogP | 2.0228 |
| CLogS | -3.48 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 239.52 |
| Relative PSA | 0.25585 |
| PolarSurfaceArea | 76.71 |
| Druglikeness | -6.6213 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7619 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-amino-N-[(Z)-2H-chromen-3-ylmethylideneamino]hexanamide | 2 - 6-amino-N-[(Z)-2H-chromen-3-ylmethylideneamino]hexanamide