| MolName | 2-naphthalen-2-yloxy-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C26H22N2O3 |
| Smiles | O=C(COc1cc2ccccc2cc1)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H22N2O3/c29-26(19-31-25-15-12-22-8-4-5-9-23(22)16-25)28-27-17-20-10-13-24(14-11-20)30-18-21-6-2-1-3-7-21/h1-17H,18-19H2,(H,28,29) |
| InChIK | PDIQATQZALFTML-UHFFFAOYSA-N |
| TotalMolweight | 410.472 |
| Molweight | 410.472 |
| MonoisotopicMass | 410.163043 |
| CLogP | 5.319 |
| CLogS | -6.448 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 328.87 |
| Relative PSA | 0.17031 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 4.1966 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70968 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-naphthalen-2-yloxy-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-naphthalen-2-yloxy-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide