| MolName | 3-[(Z)-(3-hydroxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C15H17N3O3 |
| Smiles | Oc1cccc(/C=N\N(C(C2(CCCCC2)N2)=O)C2=O)c1 |
| InChI | InChI=1S/C15H17N3O3/c19-12-6-4-5-11(9-12)10-16-18-13(20)15(17-14(18)21)7-2-1-3-8-15/h4-6,9-10,19H,1-3,7-8H2,(H,17,21) |
| InChIK | PDNJINKKLJUVQD-UHFFFAOYSA-N |
| TotalMolweight | 287.318 |
| Molweight | 287.318 |
| MonoisotopicMass | 287.126992 |
| CLogP | 1.8051 |
| CLogS | -3.44 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 213.84 |
| Relative PSA | 0.30724 |
| PolarSurfaceArea | 82 |
| Druglikeness | 1.5479 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(3-hydroxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-(3-hydroxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione