| MolName | 2-N-[(Z)-(3,5-diiodo-2-prop-2-ynoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C23H20N7O2FI2 |
| Smiles | C#CCOc(c(/C=N\Nc1nc(N2CCOCC2)nc(Nc(cc2)ccc2F)n1)cc(I)c1)c1I |
| InChI | InChI=1S/C23H20FI2N7O2/c1-2-9-35-20-15(12-17(25)13-19(20)26)14-27-32-22-29-21(28-18-5-3-16(24)4-6-18)30-23(31-22)33-7-10-34-11-8-33/h1,3-6,12-14H,7-11H2,(H2,28,29,30,31,32) |
| InChIK | PEAWWMPBFTVKML-UHFFFAOYSA-N |
| TotalMolweight | 699.257 |
| Molweight | 699.257 |
| MonoisotopicMass | 698.975197 |
| CLogP | 6.3941 |
| CLogS | -8.004 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 405.06 |
| Relative PSA | 0.22439 |
| PolarSurfaceArea | 96.79 |
| Druglikeness | 2.509 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(3,5-diiodo-2-prop-2-ynoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(3,5-diiodo-2-prop-2-ynoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine