| MolName | 2-bromo-N-[(Z)-naphthalen-1-ylmethylideneamino]benzamide |
| MolecularFormula | C18H13N2OBr |
| Smiles | O=C(c(cccc1)c1Br)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C18H13BrN2O/c19-17-11-4-3-10-16(17)18(22)21-20-12-14-8-5-7-13-6-1-2-9-15(13)14/h1-12H,(H,21,22) |
| InChIK | PENQWTUMWXVXIE-UHFFFAOYSA-N |
| TotalMolweight | 353.218 |
| Molweight | 353.218 |
| MonoisotopicMass | 352.021124 |
| CLogP | 5.1212 |
| CLogS | -6.161 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 240.22 |
| Relative PSA | 0.1499 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.6787 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| StereoCon |
Click to Load Molecule:
1 - 2-bromo-N-[(Z)-naphthalen-1-ylmethylideneamino]benzamide | 2 - 2-bromo-N-[(Z)-naphthalen-1-ylmethylideneamino]benzamide