| MolName | N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-phenyl-1H-indole-7-carboxamide |
| MolecularFormula | C22H15N3OCl2 |
| Smiles | O=C(c1c2[nH]c(-c3ccccc3)cc2ccc1)N/N=C/c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C22H15Cl2N3O/c23-18-10-9-14(11-19(18)24)13-25-27-22(28)17-8-4-7-16-12-20(26-21(16)17)15-5-2-1-3-6-15/h1-13,26H,(H,27,28) |
| InChIK | PERBCDTZWRCLIC-UHFFFAOYSA-N |
| TotalMolweight | 408.287 |
| Molweight | 408.287 |
| MonoisotopicMass | 407.059216 |
| CLogP | 6.2032 |
| CLogS | -7.496 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 301.76 |
| Relative PSA | 0.16569 |
| PolarSurfaceArea | 57.25 |
| Druglikeness | 5.0045 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-phenyl-1H-indole-7-carboxamide | 2 - N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-phenyl-1H-indole-7-carboxamide