| MolName | N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4-nitrobenzamide |
| MolecularFormula | C21H16N3O4Cl |
| Smiles | [O-][N+](c(cc1)ccc1C(N/N=C\c1cccc(OCc(cc2)ccc2Cl)c1)=O)=O |
| InChI | InChI=1S/C21H16ClN3O4/c22-18-8-4-15(5-9-18)14-29-20-3-1-2-16(12-20)13-23-24-21(26)17-6-10-19(11-7-17)25(27)28/h1-13H,14H2,(H,24,26) |
| InChIK | PEYHIHHALCRRDC-UHFFFAOYSA-N |
| TotalMolweight | 409.828 |
| Molweight | 409.828 |
| MonoisotopicMass | 409.082934 |
| CLogP | 4.2341 |
| CLogS | -6.258 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 309.6 |
| Relative PSA | 0.24687 |
| PolarSurfaceArea | 96.51 |
| Druglikeness | -1.0722 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4-nitrobenzamide | 2 - N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4-nitrobenzamide