| MolName | [1-[(Z)-[[2-(2-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate |
| MolecularFormula | C29H23N2O4Cl |
| Smiles | C=CCc(cccc1)c1OCC(N/N=C\c(c1ccccc1cc1)c1OC(c(cc1)ccc1Cl)=O)=O |
| InChI | InChI=1S/C29H23ClN2O4/c1-2-7-21-9-4-6-11-26(21)35-19-28(33)32-31-18-25-24-10-5-3-8-20(24)14-17-27(25)36-29(34)22-12-15-23(30)16-13-22/h2-6,8-18H,1,7,19H2,(H,32,33) |
| InChIK | PFQPGHLKKBJBFE-UHFFFAOYSA-N |
| TotalMolweight | 498.965 |
| Molweight | 498.965 |
| MonoisotopicMass | 498.134635 |
| CLogP | 7.0358 |
| CLogS | -8.025 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 386.58 |
| Relative PSA | 0.17862 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 1.2636 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2-(2-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate | 2 - [1-[(Z)-[[2-(2-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate