| MolName | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-morpholin-4-ylphenyl)prop-2-en-1-imine |
| MolecularFormula | C20H20N2O3 |
| Smiles | C1Oc(cc(/C=C/C=N/c(cc2)ccc2N2CCOCC2)cc2)c2O1 |
| InChI | InChI=1S/C20H20N2O3/c1(2-16-3-8-19-20(14-16)25-15-24-19)9-21-17-4-6-18(7-5-17)22-10-12-23-13-11-22/h1-9,14H,10-13,15H2 |
| InChIK | PGFDXYAHXHIQOK-UHFFFAOYSA-N |
| TotalMolweight | 336.39 |
| Molweight | 336.39 |
| MonoisotopicMass | 336.147393 |
| CLogP | 2.8321 |
| CLogS | -4.264 |
| H Acceptors | 5 |
| TotalSurfaceArea | 266.38 |
| Relative PSA | 0.16916 |
| PolarSurfaceArea | 43.29 |
| Druglikeness | 1.6325 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-(1,3-benzodioxol-5-yl)-N-(4-morpholin-4-ylphenyl)prop-2-en-1-imine | 2 - (E)-3-(1,3-benzodioxol-5-yl)-N-(4-morpholin-4-ylphenyl)prop-2-en-1-imine