| MolName | N-[2-[(2Z)-2-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C29H21N3O3BrClS |
| Smiles | O=C(CNC(c(sc1c2cccc1)c2Cl)=O)N/N=C\c(c1ccccc1cc1)c1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C29H21BrClN3O3S/c30-20-8-5-6-18(14-20)17-37-24-13-12-19-7-1-2-9-21(19)23(24)15-33-34-26(35)16-32-29(36)28-27(31)22-10-3-4-11-25(22)38-28/h1-15H,16-17H2,(H,32,36)(H,34,35) |
| InChIK | PGIFYUGXYCWKRK-UHFFFAOYSA-N |
| TotalMolweight | 606.927 |
| Molweight | 606.927 |
| MonoisotopicMass | 605.01755 |
| CLogP | 7.0802 |
| CLogS | -9.354 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 412.67 |
| Relative PSA | 0.2202 |
| PolarSurfaceArea | 108.03 |
| Druglikeness | 4.5195 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide | 2 - N-[2-[(2Z)-2-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide