| MolName | 3-[5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C20H18N5O4F |
| Smiles | OC(c1cccc(-c2ccc(/C=N\Nc(nc3)nc(N4CCOCC4)c3F)o2)c1)=O |
| InChI | InChI=1S/C20H18FN5O4/c21-16-12-22-20(24-18(16)26-6-8-29-9-7-26)25-23-11-15-4-5-17(30-15)13-2-1-3-14(10-13)19(27)28/h1-5,10-12H,6-9H2,(H,27,28)(H,22,24,25) |
| InChIK | PHCSURIKAUXLGI-UHFFFAOYSA-N |
| TotalMolweight | 411.392 |
| Molweight | 411.392 |
| MonoisotopicMass | 411.134283 |
| CLogP | 3.8516 |
| CLogS | -4.831 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 308.5 |
| Relative PSA | 0.31997 |
| PolarSurfaceArea | 113.08 |
| Druglikeness | 3.7217 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 3-[5-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid