| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-benzylideneamino]-5-[(2-carbamoylanilino)methyl]triazole-4-carboxamide |
| MolecularFormula | C20H18N10O3 |
| Smiles | NC(c(cccc1)c1NCc1c(C(N/N=C\c2ccccc2)=O)nnn1-c1nonc1N)=O |
| InChI | InChI=1S/C20H18N10O3/c21-17-19(28-33-27-17)30-15(11-23-14-9-5-4-8-13(14)18(22)31)16(25-29-30)20(32)26-24-10-12-6-2-1-3-7-12/h1-10,23H,11H2,(H2,21,27)(H2,22,31)(H,26,32) |
| InChIK | PHKPLRJJXOTNDH-UHFFFAOYSA-N |
| TotalMolweight | 446.43 |
| Molweight | 446.43 |
| MonoisotopicMass | 446.156335 |
| CLogP | 1.9018 |
| CLogS | -2.924 |
| H Acceptors | 13 |
| H Donors | 4 |
| TotalSurfaceArea | 340.45 |
| Relative PSA | 0.45795 |
| PolarSurfaceArea | 192.23 |
| Druglikeness | 2.7543 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-benzylideneamino]-5-[(2-carbamoylanilino)methyl]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-benzylideneamino]-5-[(2-carbamoylanilino)methyl]triazole-4-carboxamide