| MolName | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| MolecularFormula | C17H13N2O5Cl |
| Smiles | O=C(c(cc1)cc2c1OCCO2)N/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C17H13ClN2O5/c18-12-7-16-15(24-9-25-16)6-11(12)8-19-20-17(21)10-1-2-13-14(5-10)23-4-3-22-13/h1-2,5-8H,3-4,9H2,(H,20,21) |
| InChIK | PHMLBQFRUYRQSN-UHFFFAOYSA-N |
| TotalMolweight | 360.752 |
| Molweight | 360.752 |
| MonoisotopicMass | 360.0513 |
| CLogP | 3.8978 |
| CLogS | -5.35 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 256.69 |
| Relative PSA | 0.29612 |
| PolarSurfaceArea | 78.38 |
| Druglikeness | -2.887 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide | 2 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide