| MolName | 4-N,6-N-bis[(Z)-(4-fluorophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C29H22N8F2 |
| Smiles | Fc1ccc(/C=N\Nc2nc(N/N=C\c(cc3)ccc3F)nc(N(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H22F2N8/c30-23-15-11-21(12-16-23)19-32-37-27-34-28(38-33-20-22-13-17-24(31)18-14-22)36-29(35-27)39(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-20H,(H2,34,35,36,37,38) |
| InChIK | PHNSJADFSCJKJQ-UHFFFAOYSA-N |
| TotalMolweight | 520.546 |
| Molweight | 520.546 |
| MonoisotopicMass | 520.193548 |
| CLogP | 10.24 |
| CLogS | -9.672 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 404.02 |
| Relative PSA | 0.20395 |
| PolarSurfaceArea | 90.69 |
| Druglikeness | 1.8492 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 22 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,6-N-bis[(Z)-(4-fluorophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 4-N,6-N-bis[(Z)-(4-fluorophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine